C6H15N3 — CID 167049556
(Z)-1-[amino(methyl)amino]-N,N-dimethylprop-1-en-2-amine (PubChem CID 167049556) has the molecular formula C6H15N3 and a molecular weight of 129.21 g/mol. Its IUPAC name is (Z)-1-[amino(methyl)amino]-N,N-dimethylprop-1-en-2-amine.
| Compound Name | (Z)-1-[amino(methyl)amino]-N,N-dimethylprop-1-en-2-amine |
|---|---|
| PubChem CID | 167049556 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | (Z)-1-[amino(methyl)amino]-N,N-dimethylprop-1-en-2-amine |
| SMILES | C/C(=C/N(C)N)N(C)C |
| InChI | InChI=1S/C6H15N3/c1-6(8(2)3)5-9(4)7/h5H,7H2,1-4H3/b6-5- |
| InChIKey | YTXVUJCFVKPHSU-WAYWQWQTSA-N |
| XLogP | 0.21 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|