About hexachloroantimony(1-);2-phenyl-N-propan-2-ylacetonitrilium
hexachloroantimony(1-);2-phenyl-N-propan-2-ylacetonitrilium (PubChem CID 16705027) has the molecular formula C11H14Cl6NSb
and a molecular weight of 494.72 g/mol. Its IUPAC name is hexachloroantimony(1-);2-phenyl-N-propan-2-ylacetonitrilium.
Molecular Properties
| Compound Name | hexachloroantimony(1-);2-phenyl-N-propan-2-ylacetonitrilium |
| PubChem CID | 16705027 |
| Molecular Formula | C11H14Cl6NSb |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 490.83 |
| IUPAC Name | hexachloroantimony(1-);2-phenyl-N-propan-2-ylacetonitrilium |
| SMILES | CC(C)[N+]#CCc1ccccc1.Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H14N.6ClH.Sb/c1-10(2)12-9-8-11-6-4-3-5-7-11;;;;;;;/h3-7,10H,8H2,1-2H3;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | YATSMFPZZGSHLP-UHFFFAOYSA-H |
| XLogP | 6.73 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hexachloroantimony(1-);2-phenyl-N-propan-2-ylacetonitrilium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexachloroantimony(1-);2-phenyl-N-propan-2-ylacetonitrilium?
The IUPAC name of hexachloroantimony(1-);2-phenyl-N-propan-2-ylacetonitrilium (CID 16705027) is hexachloroantimony(1-);2-phenyl-N-propan-2-ylacetonitrilium.
What is the SMILES notation for hexachloroantimony(1-);2-phenyl-N-propan-2-ylacetonitrilium?
The canonical SMILES for hexachloroantimony(1-);2-phenyl-N-propan-2-ylacetonitrilium is CC(C)[N+]#CCc1ccccc1.Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl.
What is the InChIKey of hexachloroantimony(1-);2-phenyl-N-propan-2-ylacetonitrilium?
The InChIKey is YATSMFPZZGSHLP-UHFFFAOYSA-H. The full InChI is InChI=1S/C11H14N.6ClH.Sb/c1-10(2)12-9-8-11-6-4-3-5-7-11;;;;;;;/h3-7,10H,8H2,1-2H3;6*1H;/q+1;;;;;;;+5/p-6.
What are the key properties of hexachloroantimony(1-);2-phenyl-N-propan-2-ylacetonitrilium?
hexachloroantimony(1-);2-phenyl-N-propan-2-ylacetonitrilium has a molecular weight of 494.72 g/mol, XLogP of 6.73, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexachloroantimony(1-);2-phenyl-N-propan-2-ylacetonitrilium is sourced from PubChem (CID 16705027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).