About CID 167050598
CID 167050598 (PubChem CID 167050598) has the molecular formula C48H34F4O3S
and a molecular weight of 766.86 g/mol.
Molecular Properties
| Compound Name | CID 167050598 |
| PubChem CID | 167050598 |
| Molecular Formula | C48H34F4O3S |
| Molecular Weight | 766.86 g/mol |
| Exact Mass | 766.22 |
| IUPAC Name | — |
| SMILES | O=C1/C(=C/C2=Cc3cc4sc5cc6c(cc5c4cc3C23CCCCC3)C2(CCCCC2)C(C=C2C(=O)c3cc(F)c(F)cc3C2=O)=C6)Cc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C48H34F4O3S/c49-38-15-24-11-27(44(53)30(24)21-39(38)50)14-28-12-25-16-42-31(19-36(25)47(28)7-3-1-4-8-47)32-20-37-26(17-43(32)56-42)13-29(48(37)9-5-2-6-10-48)18-35-45(54)33-22-40(51)41(52)23-34(33)46(35)55/h12-23H,1-11H2/b27-14+ |
| InChIKey | YYQVEZNLXCCMHG-MZJWZYIUSA-N |
| XLogP | 12.18 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 766.86 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze CID 167050598 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167050598?
The IUPAC name of CID 167050598 (CID 167050598) is not available.
What is the SMILES notation for CID 167050598?
The canonical SMILES for CID 167050598 is O=C1/C(=C/C2=Cc3cc4sc5cc6c(cc5c4cc3C23CCCCC3)C2(CCCCC2)C(C=C2C(=O)c3cc(F)c(F)cc3C2=O)=C6)Cc2cc(F)c(F)cc21.
What is the InChIKey of CID 167050598?
The InChIKey is YYQVEZNLXCCMHG-MZJWZYIUSA-N. The full InChI is InChI=1S/C48H34F4O3S/c49-38-15-24-11-27(44(53)30(24)21-39(38)50)14-28-12-25-16-42-31(19-36(25)47(28)7-3-1-4-8-47)32-20-37-26(17-43(32)56-42)13-29(48(37)9-5-2-6-10-48)18-35-45(54)33-22-40(51)41(52)23-34(33)46(35)55/h12-23H,1-11H2/b27-14+.
What are the key properties of CID 167050598?
CID 167050598 has a molecular weight of 766.86 g/mol, XLogP of 12.18, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167050598 is sourced from PubChem (CID 167050598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).