C46H30F4O6S2 — CID 164759348
CID 164759348 (PubChem CID 164759348) has the molecular formula C46H30F4O6S2 and a molecular weight of 818.87 g/mol.
| Compound Name | CID 164759348 |
|---|---|
| PubChem CID | 164759348 |
| Molecular Formula | C46H30F4O6S2 |
| Molecular Weight | 818.87 g/mol |
| Exact Mass | 818.14 |
| IUPAC Name | — |
| SMILES | O=C1C(=Cc2cc3c(s2)-c2cc4c(cc2OC32CCCCC2)-c2sc(C=C3C(=O)c5cc(F)c(F)cc5C3=O)cc2C2(CCCCC2)O4)C(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C46H30F4O6S2/c47-33-15-23-24(16-34(33)48)40(52)29(39(23)51)11-21-13-31-43(57-21)27-20-38-28(19-37(27)55-45(31)7-3-1-4-8-45)44-32(46(56-38)9-5-2-6-10-46)14-22(58-44)12-30-41(53)25-17-35(49)36(50)18-26(25)42(30)54/h11-20H,1-10H2 |
| InChIKey | JRQGYUUPWCZYKA-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.87 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|