C10H15NO5S — CID 167052357
3-methyl-1-(1-methylsulfonyl-3-oxobutan-2-yl)pyrrolidine-2,5-dione (PubChem CID 167052357) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is 3-methyl-1-(1-methylsulfonyl-3-oxobutan-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-methyl-1-(1-methylsulfonyl-3-oxobutan-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 167052357 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 3-methyl-1-(1-methylsulfonyl-3-oxobutan-2-yl)pyrrolidine-2,5-dione |
| SMILES | CC(=O)C(CS(C)(=O)=O)N1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C10H15NO5S/c1-6-4-9(13)11(10(6)14)8(7(2)12)5-17(3,15)16/h6,8H,4-5H2,1-3H3 |
| InChIKey | VAIVENLIVKDXRL-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|