About 1-methyl-3-tritylurea
1-methyl-3-tritylurea (PubChem CID 167052887) has the molecular formula C21H20N2O
and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-methyl-3-tritylurea.
Molecular Properties
| Compound Name | 1-methyl-3-tritylurea |
| PubChem CID | 167052887 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-methyl-3-tritylurea |
| SMILES | CNC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O/c1-22-20(24)23-21(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H3,(H2,22,23,24) |
| InChIKey | ZXUOYXUHGAIXEW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-tritylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-tritylurea?
The IUPAC name of 1-methyl-3-tritylurea (CID 167052887) is 1-methyl-3-tritylurea.
What is the SMILES notation for 1-methyl-3-tritylurea?
The canonical SMILES for 1-methyl-3-tritylurea is CNC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-methyl-3-tritylurea?
The InChIKey is ZXUOYXUHGAIXEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O/c1-22-20(24)23-21(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H3,(H2,22,23,24).
What are the key properties of 1-methyl-3-tritylurea?
1-methyl-3-tritylurea has a molecular weight of 316.40 g/mol, XLogP of 3.91, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-tritylurea is sourced from PubChem (CID 167052887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).