C10H11F2NO2 — CID 167053349
6-tert-butyl-2,2-difluoro-[1,3]dioxolo[4,5-c]pyridine (PubChem CID 167053349) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is 6-tert-butyl-2,2-difluoro-[1,3]dioxolo[4,5-c]pyridine.
| Compound Name | 6-tert-butyl-2,2-difluoro-[1,3]dioxolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 167053349 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 6-tert-butyl-2,2-difluoro-[1,3]dioxolo[4,5-c]pyridine |
| SMILES | CC(C)(C)c1cc2c(cn1)OC(F)(F)O2 |
| InChI | InChI=1S/C10H11F2NO2/c1-9(2,3)8-4-6-7(5-13-8)15-10(11,12)14-6/h4-5H,1-3H3 |
| InChIKey | JGEXIIXXAXLRIE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |