C20H16F4 — CID 167053619
2-fluoro-4-(4-methylphenyl)-1-[(3E,5Z)-5,6,7-trifluorohepta-1,3,5-trien-3-yl]benzene (PubChem CID 167053619) has the molecular formula C20H16F4 and a molecular weight of 332.34 g/mol. Its IUPAC name is 2-fluoro-4-(4-methylphenyl)-1-[(3E,5Z)-5,6,7-trifluorohepta-1,3,5-trien-3-yl]benzene.
| Compound Name | 2-fluoro-4-(4-methylphenyl)-1-[(3E,5Z)-5,6,7-trifluorohepta-1,3,5-trien-3-yl]benzene |
|---|---|
| PubChem CID | 167053619 |
| Molecular Formula | C20H16F4 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-fluoro-4-(4-methylphenyl)-1-[(3E,5Z)-5,6,7-trifluorohepta-1,3,5-trien-3-yl]benzene |
| SMILES | C=C/C(=C\C(F)=C(\F)CF)c1ccc(-c2ccc(C)cc2)cc1F |
| InChI | InChI=1S/C20H16F4/c1-3-14(10-19(23)20(24)12-21)17-9-8-16(11-18(17)22)15-6-4-13(2)5-7-15/h3-11H,1,12H2,2H3/b14-10+,20-19- |
| InChIKey | ZZZKNFKRZRVWFQ-JVJPFGRJSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|