C38H31NO4 — CID 167054645
3-[5-(9,9-dimethylacridin-10-yl)-2-methylphenoxy]-1,4-dimethyl-9-oxoxanthene-2-carbaldehyde (PubChem CID 167054645) has the molecular formula C38H31NO4 and a molecular weight of 565.67 g/mol. Its IUPAC name is 3-[5-(9,9-dimethylacridin-10-yl)-2-methylphenoxy]-1,4-dimethyl-9-oxoxanthene-2-carbaldehyde.
| Compound Name | 3-[5-(9,9-dimethylacridin-10-yl)-2-methylphenoxy]-1,4-dimethyl-9-oxoxanthene-2-carbaldehyde |
|---|---|
| PubChem CID | 167054645 |
| Molecular Formula | C38H31NO4 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | 3-[5-(9,9-dimethylacridin-10-yl)-2-methylphenoxy]-1,4-dimethyl-9-oxoxanthene-2-carbaldehyde |
| SMILES | Cc1ccc(N2c3ccccc3C(C)(C)c3ccccc32)cc1Oc1c(C=O)c(C)c2c(=O)c3ccccc3oc2c1C |
| InChI | InChI=1S/C38H31NO4/c1-22-18-19-25(39-30-15-9-7-13-28(30)38(4,5)29-14-8-10-16-31(29)39)20-33(22)43-36-24(3)37-34(23(2)27(36)21-40)35(41)26-12-6-11-17-32(26)42-37/h6-21H,1-5H3 |
| InChIKey | WOJPFRUZKPXXCE-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|