C37H27NO4 — CID 164765311
3-(9,9-dimethylacridin-10-yl)-6,13-dimethylchromeno[3,2-b]xanthene-12,14-dione (PubChem CID 164765311) has the molecular formula C37H27NO4 and a molecular weight of 549.63 g/mol. Its IUPAC name is 3-(9,9-dimethylacridin-10-yl)-6,13-dimethylchromeno[3,2-b]xanthene-12,14-dione.
| Compound Name | 3-(9,9-dimethylacridin-10-yl)-6,13-dimethylchromeno[3,2-b]xanthene-12,14-dione |
|---|---|
| PubChem CID | 164765311 |
| Molecular Formula | C37H27NO4 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 3-(9,9-dimethylacridin-10-yl)-6,13-dimethylchromeno[3,2-b]xanthene-12,14-dione |
| SMILES | Cc1c2oc3ccccc3c(=O)c2c(C)c2c(=O)c3ccc(N4c5ccccc5C(C)(C)c5ccccc54)cc3oc12 |
| InChI | InChI=1S/C37H27NO4/c1-20-31-33(39)23-11-5-10-16-29(23)41-35(31)21(2)36-32(20)34(40)24-18-17-22(19-30(24)42-36)38-27-14-8-6-12-25(27)37(3,4)26-13-7-9-15-28(26)38/h5-19H,1-4H3 |
| InChIKey | BFVNWFMARNDCMA-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 63.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|