C24H19NO4 — CID 164765204
3-(dimethylamino)-6,13-dimethylchromeno[3,2-b]xanthene-12,14-dione (PubChem CID 164765204) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 3-(dimethylamino)-6,13-dimethylchromeno[3,2-b]xanthene-12,14-dione.
| Compound Name | 3-(dimethylamino)-6,13-dimethylchromeno[3,2-b]xanthene-12,14-dione |
|---|---|
| PubChem CID | 164765204 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 3-(dimethylamino)-6,13-dimethylchromeno[3,2-b]xanthene-12,14-dione |
| SMILES | Cc1c2oc3ccccc3c(=O)c2c(C)c2c(=O)c3ccc(N(C)C)cc3oc12 |
| InChI | InChI=1S/C24H19NO4/c1-12-19-21(26)15-7-5-6-8-17(15)28-23(19)13(2)24-20(12)22(27)16-10-9-14(25(3)4)11-18(16)29-24/h5-11H,1-4H3 |
| InChIKey | DIGSKFMSRNMDKH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 63.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|