C21H22Br2O2 — CID 167054682
(4bS,5S,8aS)-1-bromo-5-[(2-bromo-5-hydroxyphenyl)methyl]-4b-methyl-5,6,7,8,8a,9-hexahydrofluoren-4-ol (PubChem CID 167054682) has the molecular formula C21H22Br2O2 and a molecular weight of 466.21 g/mol. Its IUPAC name is (4bS,5S,8aS)-1-bromo-5-[(2-bromo-5-hydroxyphenyl)methyl]-4b-methyl-5,6,7,8,8a,9-hexahydrofluoren-4-ol.
| Compound Name | (4bS,5S,8aS)-1-bromo-5-[(2-bromo-5-hydroxyphenyl)methyl]-4b-methyl-5,6,7,8,8a,9-hexahydrofluoren-4-ol |
|---|---|
| PubChem CID | 167054682 |
| Molecular Formula | C21H22Br2O2 |
| Molecular Weight | 466.21 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | (4bS,5S,8aS)-1-bromo-5-[(2-bromo-5-hydroxyphenyl)methyl]-4b-methyl-5,6,7,8,8a,9-hexahydrofluoren-4-ol |
| SMILES | C[C@@]12c3c(O)ccc(Br)c3C[C@@H]1CCC[C@H]2Cc1cc(O)ccc1Br |
| InChI | InChI=1S/C21H22Br2O2/c1-21-13(9-12-10-15(24)5-6-17(12)22)3-2-4-14(21)11-16-18(23)7-8-19(25)20(16)21/h5-8,10,13-14,24-25H,2-4,9,11H2,1H3/t13-,14-,21-/m0/s1 |
| InChIKey | PDUBUBKLSWZQIW-RXSFTSLZSA-N |
| XLogP | 6.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.21 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |