C14H24N4O4 — CID 167055344
[1-amino-3-[4-[2-ethoxyethyl(hydroxymethyl)amino]anilino]propan-2-yl] nitrite (PubChem CID 167055344) has the molecular formula C14H24N4O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is [1-amino-3-[4-[2-ethoxyethyl(hydroxymethyl)amino]anilino]propan-2-yl] nitrite.
| Compound Name | [1-amino-3-[4-[2-ethoxyethyl(hydroxymethyl)amino]anilino]propan-2-yl] nitrite |
|---|---|
| PubChem CID | 167055344 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | [1-amino-3-[4-[2-ethoxyethyl(hydroxymethyl)amino]anilino]propan-2-yl] nitrite |
| SMILES | CCOCCN(CO)c1ccc(NCC(CN)ON=O)cc1 |
| InChI | InChI=1S/C14H24N4O4/c1-2-21-8-7-18(11-19)13-5-3-12(4-6-13)16-10-14(9-15)22-17-20/h3-6,14,16,19H,2,7-11,15H2,1H3 |
| InChIKey | SFVARCWOOAFBDC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|