C23H25ClF2N4O4 — CID 167056614
[4-chloro-3-[[5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-7-methoxyquinazolin-4-yl]amino]-2-methylphenoxy]methanol (PubChem CID 167056614) has the molecular formula C23H25ClF2N4O4 and a molecular weight of 494.93 g/mol. Its IUPAC name is [4-chloro-3-[[5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-7-methoxyquinazolin-4-yl]amino]-2-methylphenoxy]methanol.
| Compound Name | [4-chloro-3-[[5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-7-methoxyquinazolin-4-yl]amino]-2-methylphenoxy]methanol |
|---|---|
| PubChem CID | 167056614 |
| Molecular Formula | C23H25ClF2N4O4 |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | [4-chloro-3-[[5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-7-methoxyquinazolin-4-yl]amino]-2-methylphenoxy]methanol |
| SMILES | COc1cc(OC2CCN(C)CC2(F)F)c2c(Nc3c(Cl)ccc(OCO)c3C)ncnc2c1 |
| InChI | InChI=1S/C23H25ClF2N4O4/c1-13-17(33-12-31)5-4-15(24)21(13)29-22-20-16(27-11-28-22)8-14(32-3)9-18(20)34-19-6-7-30(2)10-23(19,25)26/h4-5,8-9,11,19,31H,6-7,10,12H2,1-3H3,(H,27,28,29) |
| InChIKey | AYDGKSJCYHZKRD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|