About 4-chloro-5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-6-propan-2-yloxyquinazoline
4-chloro-5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-6-propan-2-yloxyquinazoline (PubChem CID 146510078) has the molecular formula C17H20ClF2N3O2
and a molecular weight of 371.82 g/mol. Its IUPAC name is 4-chloro-5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-6-propan-2-yloxyquinazoline.
Molecular Properties
| Compound Name | 4-chloro-5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-6-propan-2-yloxyquinazoline |
| PubChem CID | 146510078 |
| Molecular Formula | C17H20ClF2N3O2 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 4-chloro-5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-6-propan-2-yloxyquinazoline |
| SMILES | CC(C)Oc1ccc2ncnc(Cl)c2c1OC1CCN(C)CC1(F)F |
| InChI | InChI=1S/C17H20ClF2N3O2/c1-10(2)24-12-5-4-11-14(16(18)22-9-21-11)15(12)25-13-6-7-23(3)8-17(13,19)20/h4-5,9-10,13H,6-8H2,1-3H3 |
| InChIKey | NDBMXMPCYGKFEB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-6-propan-2-yloxyquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-6-propan-2-yloxyquinazoline?
The IUPAC name of 4-chloro-5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-6-propan-2-yloxyquinazoline (CID 146510078) is 4-chloro-5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-6-propan-2-yloxyquinazoline.
What is the SMILES notation for 4-chloro-5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-6-propan-2-yloxyquinazoline?
The canonical SMILES for 4-chloro-5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-6-propan-2-yloxyquinazoline is CC(C)Oc1ccc2ncnc(Cl)c2c1OC1CCN(C)CC1(F)F.
What is the InChIKey of 4-chloro-5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-6-propan-2-yloxyquinazoline?
The InChIKey is NDBMXMPCYGKFEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClF2N3O2/c1-10(2)24-12-5-4-11-14(16(18)22-9-21-11)15(12)25-13-6-7-23(3)8-17(13,19)20/h4-5,9-10,13H,6-8H2,1-3H3.
What are the key properties of 4-chloro-5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-6-propan-2-yloxyquinazoline?
4-chloro-5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-6-propan-2-yloxyquinazoline has a molecular weight of 371.82 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-6-propan-2-yloxyquinazoline is sourced from PubChem (CID 146510078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).