C32H66N4O2 — CID 167059947
3-[bis(2-methylpropyl)amino]-N-[10-[3-[bis(2-methylpropyl)amino]propanoylamino]decyl]propanamide (PubChem CID 167059947) has the molecular formula C32H66N4O2 and a molecular weight of 538.91 g/mol. Its IUPAC name is 3-[bis(2-methylpropyl)amino]-N-[10-[3-[bis(2-methylpropyl)amino]propanoylamino]decyl]propanamide.
| Compound Name | 3-[bis(2-methylpropyl)amino]-N-[10-[3-[bis(2-methylpropyl)amino]propanoylamino]decyl]propanamide |
|---|---|
| PubChem CID | 167059947 |
| Molecular Formula | C32H66N4O2 |
| Molecular Weight | 538.91 g/mol |
| Exact Mass | 538.52 |
| IUPAC Name | 3-[bis(2-methylpropyl)amino]-N-[10-[3-[bis(2-methylpropyl)amino]propanoylamino]decyl]propanamide |
| SMILES | CC(C)CN(CCC(=O)NCCCCCCCCCCNC(=O)CCN(CC(C)C)CC(C)C)CC(C)C |
| InChI | InChI=1S/C32H66N4O2/c1-27(2)23-35(24-28(3)4)21-17-31(37)33-19-15-13-11-9-10-12-14-16-20-34-32(38)18-22-36(25-29(5)6)26-30(7)8/h27-30H,9-26H2,1-8H3,(H,33,37)(H,34,38) |
| InChIKey | FUDRRRXYQVISCR-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.91 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|