C12H18N2O3 — CID 167060741
[(2S)-1-(dimethylamino)-1-hydroxy-3-phenylpropan-2-yl]carbamic acid (PubChem CID 167060741) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is [(2S)-1-(dimethylamino)-1-hydroxy-3-phenylpropan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-(dimethylamino)-1-hydroxy-3-phenylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 167060741 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | [(2S)-1-(dimethylamino)-1-hydroxy-3-phenylpropan-2-yl]carbamic acid |
| SMILES | CN(C)C(O)[C@H](Cc1ccccc1)NC(=O)O |
| InChI | InChI=1S/C12H18N2O3/c1-14(2)11(15)10(13-12(16)17)8-9-6-4-3-5-7-9/h3-7,10-11,13,15H,8H2,1-2H3,(H,16,17)/t10-,11?/m0/s1 |
| InChIKey | CDVATNAVUJJOMB-VUWPPUDQSA-N |
| XLogP | 0.75 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|