C14H21N3O3 — CID 139450680
[(4R)-1-amino-4-(dimethylamino)-1-oxo-5-phenylpentan-2-yl]carbamic acid (PubChem CID 139450680) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is [(4R)-1-amino-4-(dimethylamino)-1-oxo-5-phenylpentan-2-yl]carbamic acid.
| Compound Name | [(4R)-1-amino-4-(dimethylamino)-1-oxo-5-phenylpentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 139450680 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | [(4R)-1-amino-4-(dimethylamino)-1-oxo-5-phenylpentan-2-yl]carbamic acid |
| SMILES | CN(C)[C@H](Cc1ccccc1)CC(NC(=O)O)C(N)=O |
| InChI | InChI=1S/C14H21N3O3/c1-17(2)11(8-10-6-4-3-5-7-10)9-12(13(15)18)16-14(19)20/h3-7,11-12,16H,8-9H2,1-2H3,(H2,15,18)(H,19,20)/t11-,12?/m1/s1 |
| InChIKey | WRUBMAZGLXQYOQ-JHJMLUEUSA-N |
| XLogP | 0.67 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |