C35H56INO7 — CID 167061958
[(4E,6E)-7-(4-hydroxy-5-methoxycyclohex-2-en-1-yl)-2,4,6-trimethylhepta-4,6-dien-3-yl] 1-[2-[2-hydroxy-5-(iodomethyl)-3-methyl-6-propan-2-yloxan-2-yl]acetyl]piperidine-2-carboxylate (PubChem CID 167061958) has the molecular formula C35H56INO7 and a molecular weight of 729.74 g/mol. Its IUPAC name is [(4E,6E)-7-(4-hydroxy-5-methoxycyclohex-2-en-1-yl)-2,4,6-trimethylhepta-4,6-dien-3-yl] 1-[2-[2-hydroxy-5-(iodomethyl)-3-methyl-6-propan-2-yloxan-2-yl]acetyl]piperidine-2-carboxylate.
| Compound Name | [(4E,6E)-7-(4-hydroxy-5-methoxycyclohex-2-en-1-yl)-2,4,6-trimethylhepta-4,6-dien-3-yl] 1-[2-[2-hydroxy-5-(iodomethyl)-3-methyl-6-propan-2-yloxan-2-yl]acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 167061958 |
| Molecular Formula | C35H56INO7 |
| Molecular Weight | 729.74 g/mol |
| Exact Mass | 729.31 |
| IUPAC Name | [(4E,6E)-7-(4-hydroxy-5-methoxycyclohex-2-en-1-yl)-2,4,6-trimethylhepta-4,6-dien-3-yl] 1-[2-[2-hydroxy-5-(iodomethyl)-3-methyl-6-propan-2-yloxan-2-yl]acetyl]piperidine-2-carboxylate |
| SMILES | COC1CC(/C=C(C)/C=C(\C)C(OC(=O)C2CCCCN2C(=O)CC2(O)OC(C(C)C)C(CI)CC2C)C(C)C)C=CC1O |
| InChI | InChI=1S/C35H56INO7/c1-21(2)32(24(6)15-23(5)16-26-12-13-29(38)30(18-26)42-8)43-34(40)28-11-9-10-14-37(28)31(39)19-35(41)25(7)17-27(20-36)33(44-35)22(3)4/h12-13,15-16,21-22,25-30,32-33,38,41H,9-11,14,17-20H2,1-8H3/b23-16+,24-15+ |
| InChIKey | CFOYWCDWDRHHDA-VDYLEKFBSA-N |
| XLogP | 5.99 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.74 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|