C12H21N3O3 — CID 167062705
N-nonan-2-yl-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide (PubChem CID 167062705) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is N-nonan-2-yl-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | N-nonan-2-yl-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 167062705 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | N-nonan-2-yl-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide |
| SMILES | CCCCCCCC(C)NC(=O)c1noc(=O)[nH]1 |
| InChI | InChI=1S/C12H21N3O3/c1-3-4-5-6-7-8-9(2)13-11(16)10-14-12(17)18-15-10/h9H,3-8H2,1-2H3,(H,13,16)(H,14,15,17) |
| InChIKey | DTKQJWWWSJSNGG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|