C7H11N3O3 — CID 137243240
N-butan-2-yl-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide (PubChem CID 137243240) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is N-butan-2-yl-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | N-butan-2-yl-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 137243240 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | N-butan-2-yl-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1noc(=O)[nH]1 |
| InChI | InChI=1S/C7H11N3O3/c1-3-4(2)8-6(11)5-9-7(12)13-10-5/h4H,3H2,1-2H3,(H,8,11)(H,9,10,12) |
| InChIKey | LMDBIJYMVNNUKI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |