C5H7N3O3 — CID 137232774
N-ethyl-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide (PubChem CID 137232774) has the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. Its IUPAC name is N-ethyl-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | N-ethyl-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 137232774 |
| Molecular Formula | C5H7N3O3 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | N-ethyl-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide |
| SMILES | CCNC(=O)c1noc(=O)[nH]1 |
| InChI | InChI=1S/C5H7N3O3/c1-2-6-4(9)3-7-5(10)11-8-3/h2H2,1H3,(H,6,9)(H,7,8,10) |
| InChIKey | HWUISKRUPZVOJR-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |