C6H6N4O3 — CID 137194850
N-(2-cyanoethyl)-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide (PubChem CID 137194850) has the molecular formula C6H6N4O3 and a molecular weight of 182.14 g/mol. Its IUPAC name is N-(2-cyanoethyl)-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | N-(2-cyanoethyl)-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 137194850 |
| Molecular Formula | C6H6N4O3 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | N-(2-cyanoethyl)-5-oxo-4H-1,2,4-oxadiazole-3-carboxamide |
| SMILES | N#CCCNC(=O)c1noc(=O)[nH]1 |
| InChI | InChI=1S/C6H6N4O3/c7-2-1-3-8-5(11)4-9-6(12)13-10-4/h1,3H2,(H,8,11)(H,9,10,12) |
| InChIKey | HBBXTLDZUOFAMU-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 111.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|