C16H27F3N2O — CID 167064681
2-ethyl-1-methyl-N-[4-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide (PubChem CID 167064681) has the molecular formula C16H27F3N2O and a molecular weight of 320.40 g/mol. Its IUPAC name is 2-ethyl-1-methyl-N-[4-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide.
| Compound Name | 2-ethyl-1-methyl-N-[4-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 167064681 |
| Molecular Formula | C16H27F3N2O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 2-ethyl-1-methyl-N-[4-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide |
| SMILES | CCC1CC(C(=O)NC2CCC(C(F)(F)F)CC2)CCN1C |
| InChI | InChI=1S/C16H27F3N2O/c1-3-14-10-11(8-9-21(14)2)15(22)20-13-6-4-12(5-7-13)16(17,18)19/h11-14H,3-10H2,1-2H3,(H,20,22) |
| InChIKey | PPOUXXHSKWDZTP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |