C13H22F2N2O — CID 10106678
2-amino-2-cyclohexyl-1-(4,4-difluoropiperidin-1-yl)ethanone (PubChem CID 10106678) has the molecular formula C13H22F2N2O and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-amino-2-cyclohexyl-1-(4,4-difluoropiperidin-1-yl)ethanone.
| Compound Name | 2-amino-2-cyclohexyl-1-(4,4-difluoropiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 10106678 |
| Molecular Formula | C13H22F2N2O |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-amino-2-cyclohexyl-1-(4,4-difluoropiperidin-1-yl)ethanone |
| SMILES | NC(C(=O)N1CCC(F)(F)CC1)C1CCCCC1 |
| InChI | InChI=1S/C13H22F2N2O/c14-13(15)6-8-17(9-7-13)12(18)11(16)10-4-2-1-3-5-10/h10-11H,1-9,16H2 |
| InChIKey | CTHFHOZDVQKKGT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |