C12H22N2OS — CID 142261867
(2S)-2-amino-2-cyclohexyl-1-(1,3-thiazinan-3-yl)ethanone (PubChem CID 142261867) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is (2S)-2-amino-2-cyclohexyl-1-(1,3-thiazinan-3-yl)ethanone.
| Compound Name | (2S)-2-amino-2-cyclohexyl-1-(1,3-thiazinan-3-yl)ethanone |
|---|---|
| PubChem CID | 142261867 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (2S)-2-amino-2-cyclohexyl-1-(1,3-thiazinan-3-yl)ethanone |
| SMILES | N[C@H](C(=O)N1CCCSC1)C1CCCCC1 |
| InChI | InChI=1S/C12H22N2OS/c13-11(10-5-2-1-3-6-10)12(15)14-7-4-8-16-9-14/h10-11H,1-9,13H2/t11-/m0/s1 |
| InChIKey | NXESNVZBENOPCG-NSHDSACASA-N |
| XLogP | 1.82 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |