About N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]-4-phenylbenzamide
N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]-4-phenylbenzamide (PubChem CID 10180664) has the molecular formula C24H29N3O2S
and a molecular weight of 423.58 g/mol. Its IUPAC name is N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]-4-phenylbenzamide.
Molecular Properties
| Compound Name | N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]-4-phenylbenzamide |
| PubChem CID | 10180664 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]-4-phenylbenzamide |
| SMILES | NC(C(=O)N1CCSC1)C1CCC(NC(=O)c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C24H29N3O2S/c25-22(24(29)27-14-15-30-16-27)19-10-12-21(13-11-19)26-23(28)20-8-6-18(7-9-20)17-4-2-1-3-5-17/h1-9,19,21-22H,10-16,25H2,(H,26,28) |
| InChIKey | JDNMVSSJAWCERP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]-4-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]-4-phenylbenzamide?
The IUPAC name of N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]-4-phenylbenzamide (CID 10180664) is N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]-4-phenylbenzamide.
What is the SMILES notation for N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]-4-phenylbenzamide?
The canonical SMILES for N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]-4-phenylbenzamide is NC(C(=O)N1CCSC1)C1CCC(NC(=O)c2ccc(-c3ccccc3)cc2)CC1.
What is the InChIKey of N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]-4-phenylbenzamide?
The InChIKey is JDNMVSSJAWCERP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N3O2S/c25-22(24(29)27-14-15-30-16-27)19-10-12-21(13-11-19)26-23(28)20-8-6-18(7-9-20)17-4-2-1-3-5-17/h1-9,19,21-22H,10-16,25H2,(H,26,28).
What are the key properties of N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]-4-phenylbenzamide?
N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]-4-phenylbenzamide has a molecular weight of 423.58 g/mol, XLogP of 3.50, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]-4-phenylbenzamide is sourced from PubChem (CID 10180664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).