C11H16F4N2O — CID 87844260
(2S)-2-amino-2-cyclopentyl-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone (PubChem CID 87844260) has the molecular formula C11H16F4N2O and a molecular weight of 268.25 g/mol. Its IUPAC name is (2S)-2-amino-2-cyclopentyl-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone.
| Compound Name | (2S)-2-amino-2-cyclopentyl-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 87844260 |
| Molecular Formula | C11H16F4N2O |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (2S)-2-amino-2-cyclopentyl-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone |
| SMILES | N[C@H](C(=O)N1CC(F)(F)C(F)(F)C1)C1CCCC1 |
| InChI | InChI=1S/C11H16F4N2O/c12-10(13)5-17(6-11(10,14)15)9(18)8(16)7-3-1-2-4-7/h7-8H,1-6,16H2/t8-/m0/s1 |
| InChIKey | RLIHWACNHYCJJL-QMMMGPOBSA-N |
| XLogP | 1.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|