C13H18F4N2O3 — CID 154330797
[(1S)-1-cyclohexyl-2-oxo-2-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethyl]carbamic acid (PubChem CID 154330797) has the molecular formula C13H18F4N2O3 and a molecular weight of 326.29 g/mol. Its IUPAC name is [(1S)-1-cyclohexyl-2-oxo-2-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethyl]carbamic acid.
| Compound Name | [(1S)-1-cyclohexyl-2-oxo-2-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 154330797 |
| Molecular Formula | C13H18F4N2O3 |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | [(1S)-1-cyclohexyl-2-oxo-2-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethyl]carbamic acid |
| SMILES | O=C(O)N[C@H](C(=O)N1CC(F)(F)C(F)(F)C1)C1CCCCC1 |
| InChI | InChI=1S/C13H18F4N2O3/c14-12(15)6-19(7-13(12,16)17)10(20)9(18-11(21)22)8-4-2-1-3-5-8/h8-9,18H,1-7H2,(H,21,22)/t9-/m0/s1 |
| InChIKey | IGWFKEFHYWMKRB-VIFPVBQESA-N |
| XLogP | 2.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|