About (2-λ1-thallanyloxy-2-oxoacetyl)oxythallium
(2-λ1-thallanyloxy-2-oxoacetyl)oxythallium (PubChem CID 16706493) has the molecular formula C2O4Tl2
and a molecular weight of 496.78 g/mol. Its IUPAC name is (2-λ1-thallanyloxy-2-oxoacetyl)oxythallium.
Molecular Properties
| Compound Name | (2-λ1-thallanyloxy-2-oxoacetyl)oxythallium |
| PubChem CID | 16706493 |
| Molecular Formula | C2O4Tl2 |
| Molecular Weight | 496.78 g/mol |
| Exact Mass | 497.93 |
| IUPAC Name | (2-λ1-thallanyloxy-2-oxoacetyl)oxythallium |
| SMILES | O=C(O[Tl])C(=O)O[Tl] |
| InChI | InChI=1S/C2H2O4.2Tl/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;2*+1/p-2 |
| InChIKey | WVNUZODXEDDHRM-UHFFFAOYSA-L |
| XLogP | -1.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.78 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (2-λ1-thallanyloxy-2-oxoacetyl)oxythallium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-λ1-thallanyloxy-2-oxoacetyl)oxythallium?
The IUPAC name of (2-λ1-thallanyloxy-2-oxoacetyl)oxythallium (CID 16706493) is (2-λ1-thallanyloxy-2-oxoacetyl)oxythallium.
What is the SMILES notation for (2-λ1-thallanyloxy-2-oxoacetyl)oxythallium?
The canonical SMILES for (2-λ1-thallanyloxy-2-oxoacetyl)oxythallium is O=C(O[Tl])C(=O)O[Tl].
What is the InChIKey of (2-λ1-thallanyloxy-2-oxoacetyl)oxythallium?
The InChIKey is WVNUZODXEDDHRM-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.2Tl/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;2*+1/p-2.
What are the key properties of (2-λ1-thallanyloxy-2-oxoacetyl)oxythallium?
(2-λ1-thallanyloxy-2-oxoacetyl)oxythallium has a molecular weight of 496.78 g/mol, XLogP of -1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-λ1-thallanyloxy-2-oxoacetyl)oxythallium is sourced from PubChem (CID 16706493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).