C12H12FN2O3P — CID 167064998
2-[5-(4-fluoro-2-phosphanylphenyl)-1-methylpyrazol-3-yl]oxyacetic acid (PubChem CID 167064998) has the molecular formula C12H12FN2O3P and a molecular weight of 282.21 g/mol. Its IUPAC name is 2-[5-(4-fluoro-2-phosphanylphenyl)-1-methylpyrazol-3-yl]oxyacetic acid.
| Compound Name | 2-[5-(4-fluoro-2-phosphanylphenyl)-1-methylpyrazol-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 167064998 |
| Molecular Formula | C12H12FN2O3P |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-[5-(4-fluoro-2-phosphanylphenyl)-1-methylpyrazol-3-yl]oxyacetic acid |
| SMILES | Cn1nc(OCC(=O)O)cc1-c1ccc(F)cc1P |
| InChI | InChI=1S/C12H12FN2O3P/c1-15-9(5-11(14-15)18-6-12(16)17)8-3-2-7(13)4-10(8)19/h2-5H,6,19H2,1H3,(H,16,17) |
| InChIKey | FXQICUMFCHHGOC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|