2-[4-(2,5-difluorophenyl)phenoxy]acetic acid

C14H10F2O3 — CID 82039119

IUPAC2-[4-(2,5-difluorophenyl)phenoxy]acetic acid
SMILESO=C(O)COc1ccc(-c2cc(F)ccc2F)cc1
InChIInChI=1S/C14H10F2O3/c15-10-3-6-13(16)12(7-10)9-1-4-11(5-2-9)19-8-14(17)18/h1-7H,8H2,(H,17,18)
InChIKeyMRQICJQBZUZKLM-UHFFFAOYSA-N
MW264.23 g/mol
LogP3.10
Rot. Bonds4

About 2-[4-(2,5-difluorophenyl)phenoxy]acetic acid

2-[4-(2,5-difluorophenyl)phenoxy]acetic acid (PubChem CID 82039119) has the molecular formula C14H10F2O3 and a molecular weight of 264.23 g/mol. Its IUPAC name is 2-[4-(2,5-difluorophenyl)phenoxy]acetic acid.

Molecular Properties

Compound Name2-[4-(2,5-difluorophenyl)phenoxy]acetic acid
PubChem CID82039119
Molecular FormulaC14H10F2O3
Molecular Weight264.23 g/mol
Exact Mass264.06
IUPAC Name2-[4-(2,5-difluorophenyl)phenoxy]acetic acid
SMILESO=C(O)COc1ccc(-c2cc(F)ccc2F)cc1
InChIInChI=1S/C14H10F2O3/c15-10-3-6-13(16)12(7-10)9-1-4-11(5-2-9)19-8-14(17)18/h1-7H,8H2,(H,17,18)
InChIKeyMRQICJQBZUZKLM-UHFFFAOYSA-N
XLogP3.10
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.23
LogP ≤ 53.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[4-(2,5-difluorophenyl)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[5-(2,5-difluorophenyl)-2-fluorophenyl]acetic acid
CID 176548294
3-[4-(5-chloro-2-fluorophenyl)phenoxy]propanoic acid
CID 171854747
2-[4-(5-chloro-2-methylphenyl)phenoxy]acetic acid
CID 82039313
2-(3-bromo-4-fluorophenoxy)acetic acid
CID 83231542
2-[4-(2-hydroxyphenyl)phenoxy]acetic acid
CID 10776663
bis(2-(4-chlorophenoxy)acetic acid);zinc
CID 11201418
2-[3-(4-fluorophenyl)-2-oxochromen-7-yl]oxyacetic acid
CID 1382977
2-[3-(2-fluorophenyl)phenoxy]acetic acid
CID 39349094
2-[4-(3,5-dimethylphenyl)phenoxy]acetic acid
CID 66680223
2-(4-fluoro-3-propan-2-ylphenoxy)acetic acid
CID 126565610
2-[4-(5-amino-2-methylphenyl)phenoxy]acetic acid
CID 82039012
ethane;2-(3-fluoro-4-methylphenoxy)acetic acid
CID 155714293

Frequently Asked Questions

What is the IUPAC name of 2-[4-(2,5-difluorophenyl)phenoxy]acetic acid?
The IUPAC name of 2-[4-(2,5-difluorophenyl)phenoxy]acetic acid (CID 82039119) is 2-[4-(2,5-difluorophenyl)phenoxy]acetic acid.
What is the SMILES notation for 2-[4-(2,5-difluorophenyl)phenoxy]acetic acid?
The canonical SMILES for 2-[4-(2,5-difluorophenyl)phenoxy]acetic acid is O=C(O)COc1ccc(-c2cc(F)ccc2F)cc1.
What is the InChIKey of 2-[4-(2,5-difluorophenyl)phenoxy]acetic acid?
The InChIKey is MRQICJQBZUZKLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F2O3/c15-10-3-6-13(16)12(7-10)9-1-4-11(5-2-9)19-8-14(17)18/h1-7H,8H2,(H,17,18).
What are the key properties of 2-[4-(2,5-difluorophenyl)phenoxy]acetic acid?
2-[4-(2,5-difluorophenyl)phenoxy]acetic acid has a molecular weight of 264.23 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,5-difluorophenyl)phenoxy]acetic acid is sourced from PubChem (CID 82039119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).