C10H16N2 — CID 167067973
N-[(Z)-hex-2-en-2-yl]-3H-pyrrol-2-amine (PubChem CID 167067973) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-[(Z)-hex-2-en-2-yl]-3H-pyrrol-2-amine.
| Compound Name | N-[(Z)-hex-2-en-2-yl]-3H-pyrrol-2-amine |
|---|---|
| PubChem CID | 167067973 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-[(Z)-hex-2-en-2-yl]-3H-pyrrol-2-amine |
| SMILES | CCC/C=C(/C)NC1=NC=CC1 |
| InChI | InChI=1S/C10H16N2/c1-3-4-6-9(2)12-10-7-5-8-11-10/h5-6,8H,3-4,7H2,1-2H3,(H,11,12)/b9-6- |
| InChIKey | NFGBBWFOKSLATQ-TWGQIWQCSA-N |
| XLogP | 2.60 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |