C48H57N — CID 167068863
1-(3,5-ditert-butylphenyl)-9-[3-(3,5-ditert-butylphenyl)-2-ethylphenyl]carbazole (PubChem CID 167068863) has the molecular formula C48H57N and a molecular weight of 647.99 g/mol. Its IUPAC name is 1-(3,5-ditert-butylphenyl)-9-[3-(3,5-ditert-butylphenyl)-2-ethylphenyl]carbazole.
| Compound Name | 1-(3,5-ditert-butylphenyl)-9-[3-(3,5-ditert-butylphenyl)-2-ethylphenyl]carbazole |
|---|---|
| PubChem CID | 167068863 |
| Molecular Formula | C48H57N |
| Molecular Weight | 647.99 g/mol |
| Exact Mass | 647.45 |
| IUPAC Name | 1-(3,5-ditert-butylphenyl)-9-[3-(3,5-ditert-butylphenyl)-2-ethylphenyl]carbazole |
| SMILES | CCc1c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cccc1-n1c2ccccc2c2cccc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c21 |
| InChI | InChI=1S/C48H57N/c1-14-37-38(31-25-33(45(2,3)4)29-34(26-31)46(5,6)7)20-18-24-42(37)49-43-23-16-15-19-40(43)41-22-17-21-39(44(41)49)32-27-35(47(8,9)10)30-36(28-32)48(11,12)13/h15-30H,14H2,1-13H3 |
| InChIKey | VCEGZFOSEPERBW-UHFFFAOYSA-N |
| XLogP | 13.87 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.99 |
| LogP ≤ 5 | 13.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |