C35H34N4 — CID 170008009
9-[2-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-1-phenylcarbazole (PubChem CID 170008009) has the molecular formula C35H34N4 and a molecular weight of 510.69 g/mol. Its IUPAC name is 9-[2-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-1-phenylcarbazole.
| Compound Name | 9-[2-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-1-phenylcarbazole |
|---|---|
| PubChem CID | 170008009 |
| Molecular Formula | C35H34N4 |
| Molecular Weight | 510.69 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | 9-[2-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-1-phenylcarbazole |
| SMILES | CC(C)(C)c1nc(-c2ccccc2-n2c3ccccc3c3cccc(-c4ccccc4)c32)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C35H34N4/c1-34(2,3)32-36-31(37-33(38-32)35(4,5)6)27-18-11-13-22-29(27)39-28-21-12-10-17-25(28)26-20-14-19-24(30(26)39)23-15-8-7-9-16-23/h7-22H,1-6H3 |
| InChIKey | PMWVWYVEKPKGEM-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.69 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |