C41H38N4 — CID 170007998
9-[2-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-3,6-diphenylcarbazole (PubChem CID 170007998) has the molecular formula C41H38N4 and a molecular weight of 586.78 g/mol. Its IUPAC name is 9-[2-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[2-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 170007998 |
| Molecular Formula | C41H38N4 |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | 9-[2-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-3,6-diphenylcarbazole |
| SMILES | CC(C)(C)c1nc(-c2ccccc2-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C41H38N4/c1-40(2,3)38-42-37(43-39(44-38)41(4,5)6)31-19-13-14-20-34(31)45-35-23-21-29(27-15-9-7-10-16-27)25-32(35)33-26-30(22-24-36(33)45)28-17-11-8-12-18-28/h7-26H,1-6H3 |
| InChIKey | WKKHOMQSUYMZIB-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |