C66H52N2 — CID 167073633
2,4-diphenyl-N-(4-phenylphenyl)-N-[4-[4-(4-phenyl-N-[(3E,5E)-6-phenylhexa-1,3,5-trien-3-yl]anilino)phenyl]cyclohexa-1,5-dien-1-yl]aniline (PubChem CID 167073633) has the molecular formula C66H52N2 and a molecular weight of 873.16 g/mol. Its IUPAC name is 2,4-diphenyl-N-(4-phenylphenyl)-N-[4-[4-(4-phenyl-N-[(3E,5E)-6-phenylhexa-1,3,5-trien-3-yl]anilino)phenyl]cyclohexa-1,5-dien-1-yl]aniline.
| Compound Name | 2,4-diphenyl-N-(4-phenylphenyl)-N-[4-[4-(4-phenyl-N-[(3E,5E)-6-phenylhexa-1,3,5-trien-3-yl]anilino)phenyl]cyclohexa-1,5-dien-1-yl]aniline |
|---|---|
| PubChem CID | 167073633 |
| Molecular Formula | C66H52N2 |
| Molecular Weight | 873.16 g/mol |
| Exact Mass | 872.41 |
| IUPAC Name | 2,4-diphenyl-N-(4-phenylphenyl)-N-[4-[4-(4-phenyl-N-[(3E,5E)-6-phenylhexa-1,3,5-trien-3-yl]anilino)phenyl]cyclohexa-1,5-dien-1-yl]aniline |
| SMILES | C=C/C(=C\C=C\c1ccccc1)N(c1ccc(-c2ccccc2)cc1)c1ccc(C2C=CC(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3-c3ccccc3)=CC2)cc1 |
| InChI | InChI=1S/C66H52N2/c1-2-60(30-18-21-50-19-8-3-9-20-50)67(61-40-31-54(32-41-61)51-22-10-4-11-23-51)62-42-33-56(34-43-62)57-37-46-64(47-38-57)68(63-44-35-55(36-45-63)52-24-12-5-13-25-52)66-48-39-59(53-26-14-6-15-27-53)49-65(66)58-28-16-7-17-29-58/h2-37,39-49,57H,1,38H2/b21-18+,60-30+ |
| InChIKey | QKBVKFCZRUZWFI-USTQSDOLSA-N |
| XLogP | 18.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.16 |
| LogP ≤ 5 | 18.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|