C16H16ClF2N3O2 — CID 167075509
4-chloro-N-[2-(2-cyano-4-methylpyrrolidin-1-yl)-2-oxoethyl]-2,3-difluoro-N-methylbenzamide (PubChem CID 167075509) has the molecular formula C16H16ClF2N3O2 and a molecular weight of 355.77 g/mol. Its IUPAC name is 4-chloro-N-[2-(2-cyano-4-methylpyrrolidin-1-yl)-2-oxoethyl]-2,3-difluoro-N-methylbenzamide.
| Compound Name | 4-chloro-N-[2-(2-cyano-4-methylpyrrolidin-1-yl)-2-oxoethyl]-2,3-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 167075509 |
| Molecular Formula | C16H16ClF2N3O2 |
| Molecular Weight | 355.77 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 4-chloro-N-[2-(2-cyano-4-methylpyrrolidin-1-yl)-2-oxoethyl]-2,3-difluoro-N-methylbenzamide |
| SMILES | CC1CC(C#N)N(C(=O)CN(C)C(=O)c2ccc(Cl)c(F)c2F)C1 |
| InChI | InChI=1S/C16H16ClF2N3O2/c1-9-5-10(6-20)22(7-9)13(23)8-21(2)16(24)11-3-4-12(17)15(19)14(11)18/h3-4,9-10H,5,7-8H2,1-2H3 |
| InChIKey | NTMPOLUKLMXPMV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.77 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|