C27H29N5O5 — CID 167076962
N-[(2S)-1-[[(1S,2S,6R,8S)-8-cyano-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undecan-8-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-4-methoxy-1H-indole-2-carboxamide (PubChem CID 167076962) has the molecular formula C27H29N5O5 and a molecular weight of 503.56 g/mol. Its IUPAC name is N-[(2S)-1-[[(1S,2S,6R,8S)-8-cyano-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undecan-8-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-4-methoxy-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-1-[[(1S,2S,6R,8S)-8-cyano-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undecan-8-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-4-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167076962 |
| Molecular Formula | C27H29N5O5 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | N-[(2S)-1-[[(1S,2S,6R,8S)-8-cyano-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undecan-8-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-4-methoxy-1H-indole-2-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)N[C@@H](CC3CC3)C(=O)N[C@@]3(C#N)C[C@@H]4CCC3[C@H]3C(=O)NC(=O)[C@@H]43)cc12 |
| InChI | InChI=1S/C27H29N5O5/c1-37-20-4-2-3-17-15(20)10-19(29-17)23(33)30-18(9-13-5-6-13)24(34)32-27(12-28)11-14-7-8-16(27)22-21(14)25(35)31-26(22)36/h2-4,10,13-14,16,18,21-22,29H,5-9,11H2,1H3,(H,30,33)(H,32,34)(H,31,35,36)/t14-,16?,18-,21-,22+,27+/m0/s1 |
| InChIKey | SWNZZEKMTZHUEK-HREYBEBUSA-N |
| XLogP | 1.77 |
| TPSA | 153.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|