C26H31N5O4 — CID 174028079
N-[(2S)-1-[[(3aS,4S,5S)-5-cyano-4-methyl-3-oxo-2,3a,4,6,7,7a-hexahydro-1H-isoindol-5-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-4-methoxy-1H-indole-2-carboxamide (PubChem CID 174028079) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is N-[(2S)-1-[[(3aS,4S,5S)-5-cyano-4-methyl-3-oxo-2,3a,4,6,7,7a-hexahydro-1H-isoindol-5-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-4-methoxy-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-1-[[(3aS,4S,5S)-5-cyano-4-methyl-3-oxo-2,3a,4,6,7,7a-hexahydro-1H-isoindol-5-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-4-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 174028079 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | N-[(2S)-1-[[(3aS,4S,5S)-5-cyano-4-methyl-3-oxo-2,3a,4,6,7,7a-hexahydro-1H-isoindol-5-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-4-methoxy-1H-indole-2-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)N[C@@H](CC3CC3)C(=O)N[C@@]3(C#N)CCC4CNC(=O)[C@@H]4[C@@H]3C)cc12 |
| InChI | InChI=1S/C26H31N5O4/c1-14-22-16(12-28-25(22)34)8-9-26(14,13-27)31-24(33)19(10-15-6-7-15)30-23(32)20-11-17-18(29-20)4-3-5-21(17)35-2/h3-5,11,14-16,19,22,29H,6-10,12H2,1-2H3,(H,28,34)(H,30,32)(H,31,33)/t14-,16?,19-,22+,26+/m0/s1 |
| InChIKey | LIAIHXIKIQPOII-RCLFZTKKSA-N |
| XLogP | 2.25 |
| TPSA | 136.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |