C16H29N3O2 — CID 167079450
tert-butyl N-[(1S,5R)-8-(3-methyliminopropyl)-8-azabicyclo[3.2.1]octan-3-yl]carbamate (PubChem CID 167079450) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is tert-butyl N-[(1S,5R)-8-(3-methyliminopropyl)-8-azabicyclo[3.2.1]octan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,5R)-8-(3-methyliminopropyl)-8-azabicyclo[3.2.1]octan-3-yl]carbamate |
|---|---|
| PubChem CID | 167079450 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | tert-butyl N-[(1S,5R)-8-(3-methyliminopropyl)-8-azabicyclo[3.2.1]octan-3-yl]carbamate |
| SMILES | C/N=C/CCN1[C@@H]2CC[C@H]1CC(NC(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C16H29N3O2/c1-16(2,3)21-15(20)18-12-10-13-6-7-14(11-12)19(13)9-5-8-17-4/h8,12-14H,5-7,9-11H2,1-4H3,(H,18,20)/b17-8+/t12?,13-,14+ |
| InChIKey | GSZTYVVQBDPQPX-GYEOVLMISA-N |
| XLogP | 2.60 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|