C11H22F3N3 — CID 167080240
2-N-[(E)-2-methyl-3-(trifluoromethyl)hex-3-en-2-yl]propane-1,2,3-triamine (PubChem CID 167080240) has the molecular formula C11H22F3N3 and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-N-[(E)-2-methyl-3-(trifluoromethyl)hex-3-en-2-yl]propane-1,2,3-triamine.
| Compound Name | 2-N-[(E)-2-methyl-3-(trifluoromethyl)hex-3-en-2-yl]propane-1,2,3-triamine |
|---|---|
| PubChem CID | 167080240 |
| Molecular Formula | C11H22F3N3 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-N-[(E)-2-methyl-3-(trifluoromethyl)hex-3-en-2-yl]propane-1,2,3-triamine |
| SMILES | CC/C=C(/C(F)(F)F)C(C)(C)NC(CN)CN |
| InChI | InChI=1S/C11H22F3N3/c1-4-5-9(11(12,13)14)10(2,3)17-8(6-15)7-16/h5,8,17H,4,6-7,15-16H2,1-3H3/b9-5+ |
| InChIKey | QTLIAWGJIBBVPQ-WEVVVXLNSA-N |
| XLogP | 1.54 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|