C16H30IN3O6P2 — CID 167081665
[2-[2-[benzyl(ethyl)amino]ethyl-[[hydroxy(iodooxy)phosphoryl]methyl]amino]ethyl-methylamino]methylphosphonic acid (PubChem CID 167081665) has the molecular formula C16H30IN3O6P2 and a molecular weight of 549.28 g/mol. Its IUPAC name is [2-[2-[benzyl(ethyl)amino]ethyl-[[hydroxy(iodooxy)phosphoryl]methyl]amino]ethyl-methylamino]methylphosphonic acid.
| Compound Name | [2-[2-[benzyl(ethyl)amino]ethyl-[[hydroxy(iodooxy)phosphoryl]methyl]amino]ethyl-methylamino]methylphosphonic acid |
|---|---|
| PubChem CID | 167081665 |
| Molecular Formula | C16H30IN3O6P2 |
| Molecular Weight | 549.28 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | [2-[2-[benzyl(ethyl)amino]ethyl-[[hydroxy(iodooxy)phosphoryl]methyl]amino]ethyl-methylamino]methylphosphonic acid |
| SMILES | CCN(CCN(CCN(C)CP(=O)(O)O)CP(=O)(O)OI)Cc1ccccc1 |
| InChI | InChI=1S/C16H30IN3O6P2/c1-3-19(13-16-7-5-4-6-8-16)11-12-20(15-28(24,25)26-17)10-9-18(2)14-27(21,22)23/h4-8H,3,9-15H2,1-2H3,(H,24,25)(H2,21,22,23) |
| InChIKey | QOFOJIMOCQGEOV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|