C30H42N4O6P3-3 — CID 18787728
[2-[bis[2-[methyl-[[oxido(phenyl)phosphoryl]methyl]amino]ethyl]amino]ethyl-methylamino]methyl-phenylphosphinate (PubChem CID 18787728) has the molecular formula C30H42N4O6P3-3 and a molecular weight of 647.61 g/mol. Its IUPAC name is [2-[bis[2-[methyl-[[oxido(phenyl)phosphoryl]methyl]amino]ethyl]amino]ethyl-methylamino]methyl-phenylphosphinate.
| Compound Name | [2-[bis[2-[methyl-[[oxido(phenyl)phosphoryl]methyl]amino]ethyl]amino]ethyl-methylamino]methyl-phenylphosphinate |
|---|---|
| PubChem CID | 18787728 |
| Molecular Formula | C30H42N4O6P3-3 |
| Molecular Weight | 647.61 g/mol |
| Exact Mass | 647.23 |
| IUPAC Name | [2-[bis[2-[methyl-[[oxido(phenyl)phosphoryl]methyl]amino]ethyl]amino]ethyl-methylamino]methyl-phenylphosphinate |
| SMILES | CN(CCN(CCN(C)CP(=O)([O-])c1ccccc1)CCN(C)CP(=O)([O-])c1ccccc1)CP(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C30H45N4O6P3/c1-31(25-41(35,36)28-13-7-4-8-14-28)19-22-34(23-20-32(2)26-42(37,38)29-15-9-5-10-16-29)24-21-33(3)27-43(39,40)30-17-11-6-12-18-30/h4-18H,19-27H2,1-3H3,(H,35,36)(H,37,38)(H,39,40)/p-3 |
| InChIKey | NBWMKUJMRFFOFK-UHFFFAOYSA-K |
| XLogP | 0.85 |
| TPSA | 133.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.61 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|