C32H38N2O2P2 — CID 24891588
N,N'-bis(diphenylphosphoryl)-N,N'-di(propan-2-yl)ethane-1,2-diamine (PubChem CID 24891588) has the molecular formula C32H38N2O2P2 and a molecular weight of 544.62 g/mol. Its IUPAC name is N,N'-bis(diphenylphosphoryl)-N,N'-di(propan-2-yl)ethane-1,2-diamine.
| Compound Name | N,N'-bis(diphenylphosphoryl)-N,N'-di(propan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 24891588 |
| Molecular Formula | C32H38N2O2P2 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | N,N'-bis(diphenylphosphoryl)-N,N'-di(propan-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)N(CCN(C(C)C)P(=O)(c1ccccc1)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H38N2O2P2/c1-27(2)33(37(35,29-17-9-5-10-18-29)30-19-11-6-12-20-30)25-26-34(28(3)4)38(36,31-21-13-7-14-22-31)32-23-15-8-16-24-32/h5-24,27-28H,25-26H2,1-4H3 |
| InChIKey | DNZUIWUYXUBRTF-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|