C10H17FN2O — CID 167081721
2-fluoro-1-[(2S,6R)-2,4,6-trimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 167081721) has the molecular formula C10H17FN2O and a molecular weight of 200.26 g/mol. Its IUPAC name is 2-fluoro-1-[(2S,6R)-2,4,6-trimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 2-fluoro-1-[(2S,6R)-2,4,6-trimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167081721 |
| Molecular Formula | C10H17FN2O |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-fluoro-1-[(2S,6R)-2,4,6-trimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1[C@H](C)CN(C)C[C@@H]1C |
| InChI | InChI=1S/C10H17FN2O/c1-7-5-12(4)6-8(2)13(7)10(14)9(3)11/h7-8H,3,5-6H2,1-2,4H3/t7-,8+ |
| InChIKey | VVGZQRLODVFZFI-OCAPTIKFSA-N |
| XLogP | 1.02 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|