C26H28F3N7OS — CID 167084604
N-[N-[3-[[1-[(2-cyano-4-methyl-1H-indol-5-yl)methyl]piperidin-4-yl]iminomethyl]-5-(2,2,2-trifluoroethyl)thiophen-2-yl]-N'-methylcarbamimidoyl]formamide (PubChem CID 167084604) has the molecular formula C26H28F3N7OS and a molecular weight of 543.62 g/mol. Its IUPAC name is N-[N-[3-[[1-[(2-cyano-4-methyl-1H-indol-5-yl)methyl]piperidin-4-yl]iminomethyl]-5-(2,2,2-trifluoroethyl)thiophen-2-yl]-N'-methylcarbamimidoyl]formamide.
| Compound Name | N-[N-[3-[[1-[(2-cyano-4-methyl-1H-indol-5-yl)methyl]piperidin-4-yl]iminomethyl]-5-(2,2,2-trifluoroethyl)thiophen-2-yl]-N'-methylcarbamimidoyl]formamide |
|---|---|
| PubChem CID | 167084604 |
| Molecular Formula | C26H28F3N7OS |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | N-[N-[3-[[1-[(2-cyano-4-methyl-1H-indol-5-yl)methyl]piperidin-4-yl]iminomethyl]-5-(2,2,2-trifluoroethyl)thiophen-2-yl]-N'-methylcarbamimidoyl]formamide |
| SMILES | C/N=C(\NC=O)Nc1sc(CC(F)(F)F)cc1/C=N/C1CCN(Cc2ccc3[nH]c(C#N)cc3c2C)CC1 |
| InChI | InChI=1S/C26H28F3N7OS/c1-16-17(3-4-23-22(16)10-20(12-30)34-23)14-36-7-5-19(6-8-36)32-13-18-9-21(11-26(27,28)29)38-24(18)35-25(31-2)33-15-37/h3-4,9-10,13,15,19,34H,5-8,11,14H2,1-2H3,(H2,31,33,35,37)/b32-13+ |
| InChIKey | LBDLAHMTDHRIED-JJKQSNDFSA-N |
| XLogP | 4.74 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|