C18H18ClN3OS — CID 167085406
2-[4-chloro-1-(oxan-4-ylmethyl)phthalazin-6-yl]-5-methyl-1,3-thiazole (PubChem CID 167085406) has the molecular formula C18H18ClN3OS and a molecular weight of 359.88 g/mol. Its IUPAC name is 2-[4-chloro-1-(oxan-4-ylmethyl)phthalazin-6-yl]-5-methyl-1,3-thiazole.
| Compound Name | 2-[4-chloro-1-(oxan-4-ylmethyl)phthalazin-6-yl]-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 167085406 |
| Molecular Formula | C18H18ClN3OS |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2-[4-chloro-1-(oxan-4-ylmethyl)phthalazin-6-yl]-5-methyl-1,3-thiazole |
| SMILES | Cc1cnc(-c2ccc3c(CC4CCOCC4)nnc(Cl)c3c2)s1 |
| InChI | InChI=1S/C18H18ClN3OS/c1-11-10-20-18(24-11)13-2-3-14-15(9-13)17(19)22-21-16(14)8-12-4-6-23-7-5-12/h2-3,9-10,12H,4-8H2,1H3 |
| InChIKey | PCVSNMGECCEKPJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |