C25H23ClN4O7S2 — CID 167085973
methyl 4-[[5-[[(6R)-6-amino-2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.4]oct-7-yn-6-yl]carbamoyl]furan-2-yl]sulfonothioylamino]-4-oxobutanoate (PubChem CID 167085973) has the molecular formula C25H23ClN4O7S2 and a molecular weight of 591.07 g/mol. Its IUPAC name is methyl 4-[[5-[[(6R)-6-amino-2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.4]oct-7-yn-6-yl]carbamoyl]furan-2-yl]sulfonothioylamino]-4-oxobutanoate.
| Compound Name | methyl 4-[[5-[[(6R)-6-amino-2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.4]oct-7-yn-6-yl]carbamoyl]furan-2-yl]sulfonothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 167085973 |
| Molecular Formula | C25H23ClN4O7S2 |
| Molecular Weight | 591.07 g/mol |
| Exact Mass | 590.07 |
| IUPAC Name | methyl 4-[[5-[[(6R)-6-amino-2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.4]oct-7-yn-6-yl]carbamoyl]furan-2-yl]sulfonothioylamino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)NS(=O)(=S)c1ccc(C(=O)N[C@@]2(N)C#CC3(CC(c4nc5cc(Cl)ccc5o4)C3)C2)o1 |
| InChI | InChI=1S/C25H23ClN4O7S2/c1-35-20(32)6-5-19(31)30-39(34,38)21-7-4-18(36-21)22(33)29-25(27)9-8-24(13-25)11-14(12-24)23-28-16-10-15(26)2-3-17(16)37-23/h2-4,7,10,14H,5-6,11-13,27H2,1H3,(H,29,33)(H,30,31)/t14?,24?,25-,39?/m0/s1 |
| InChIKey | HVJIKEIYLNEJFW-PEJZDSBASA-N |
| XLogP | 2.52 |
| TPSA | 166.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.07 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|