C15H20O7 — CID 167088339
3-methoxy-4-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxybenzaldehyde (PubChem CID 167088339) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is 3-methoxy-4-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxybenzaldehyde.
| Compound Name | 3-methoxy-4-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxybenzaldehyde |
|---|---|
| PubChem CID | 167088339 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 3-methoxy-4-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxybenzaldehyde |
| SMILES | COc1cc(C=O)ccc1O[C@@H]1C[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H20O7/c1-21-11-4-8(6-16)2-3-10(11)22-12-5-9(7-17)13(18)15(20)14(12)19/h2-4,6,9,12-15,17-20H,5,7H2,1H3/t9-,12-,13-,14+,15+/m1/s1 |
| InChIKey | KVWIZLYPEPXIQS-NSAPBPOKSA-N |
| XLogP | -0.65 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|